Implement right-click color editor modal for customizable calendar colors
- Add ColorEditorModal component with full color picker interface - Replace theme-dependent colors with unified color palette - Store custom colors in database via preferences API for cross-device sync - Add right-click handlers on color dots to open editor modal - Fix event bubbling to prevent calendar context menu conflicts - Add comprehensive CSS styling for modal with proper positioning 🤖 Generated with [Claude Code](https://claude.ai/code) Co-Authored-By: Claude <noreply@anthropic.com>
This commit is contained in:
@@ -1,5 +1,5 @@
|
||||
use crate::components::{
|
||||
CalendarContextMenu, CalendarManagementModal, ContextMenu, CreateEventModal, DeleteAction,
|
||||
CalendarContextMenu, CalendarManagementModal, ColorEditorModal, ContextMenu, CreateEventModal, DeleteAction,
|
||||
EditAction, EventContextMenu, EventModal, EventCreationData,
|
||||
MobileWarningModal, RouteHandler, Sidebar, Theme, ViewMode,
|
||||
};
|
||||
@@ -15,18 +15,44 @@ use web_sys::MouseEvent;
|
||||
use yew::prelude::*;
|
||||
use yew_router::prelude::*;
|
||||
|
||||
fn get_theme_event_colors() -> Vec<String> {
|
||||
if let Some(window) = web_sys::window() {
|
||||
if let Some(document) = window.document() {
|
||||
if let Some(root) = document.document_element() {
|
||||
if let Ok(Some(computed_style)) = window.get_computed_style(&root) {
|
||||
if let Ok(colors_string) = computed_style.get_property_value("--event-colors") {
|
||||
if !colors_string.is_empty() {
|
||||
return colors_string
|
||||
.split(',')
|
||||
.map(|color| color.trim().to_string())
|
||||
.filter(|color| !color.is_empty())
|
||||
.collect();
|
||||
fn get_default_event_colors() -> Vec<String> {
|
||||
vec![
|
||||
"#3B82F6".to_string(), // Blue
|
||||
"#10B981".to_string(), // Emerald
|
||||
"#F59E0B".to_string(), // Amber
|
||||
"#EF4444".to_string(), // Red
|
||||
"#8B5CF6".to_string(), // Violet
|
||||
"#06B6D4".to_string(), // Cyan
|
||||
"#84CC16".to_string(), // Lime
|
||||
"#F97316".to_string(), // Orange
|
||||
"#EC4899".to_string(), // Pink
|
||||
"#6366F1".to_string(), // Indigo
|
||||
"#14B8A6".to_string(), // Teal
|
||||
"#F3B806".to_string(), // Yellow
|
||||
"#8B5A2B".to_string(), // Brown
|
||||
"#6B7280".to_string(), // Gray
|
||||
"#DC2626".to_string(), // Dark Red
|
||||
"#7C3AED".to_string(), // Purple
|
||||
]
|
||||
}
|
||||
|
||||
fn get_event_colors_from_preferences() -> Vec<String> {
|
||||
// Try to load custom colors from user preferences
|
||||
if let Some(prefs) = crate::services::preferences::PreferencesService::load_cached() {
|
||||
if let Some(colors_json) = prefs.calendar_colors {
|
||||
// Try to parse the JSON structure
|
||||
if let Ok(colors_data) = serde_json::from_str::<serde_json::Value>(&colors_json) {
|
||||
// Check if it has a custom_palette field
|
||||
if let Some(custom_palette) = colors_data.get("custom_palette") {
|
||||
if let Some(colors_array) = custom_palette.as_array() {
|
||||
let custom_colors: Vec<String> = colors_array
|
||||
.iter()
|
||||
.filter_map(|v| v.as_str().map(|s| s.to_string()))
|
||||
.collect();
|
||||
|
||||
// Only use custom colors if we have a reasonable number
|
||||
if custom_colors.len() >= 8 {
|
||||
return custom_colors;
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -34,24 +60,23 @@ fn get_theme_event_colors() -> Vec<String> {
|
||||
}
|
||||
}
|
||||
|
||||
vec![
|
||||
"#3B82F6".to_string(),
|
||||
"#10B981".to_string(),
|
||||
"#F59E0B".to_string(),
|
||||
"#EF4444".to_string(),
|
||||
"#8B5CF6".to_string(),
|
||||
"#06B6D4".to_string(),
|
||||
"#84CC16".to_string(),
|
||||
"#F97316".to_string(),
|
||||
"#EC4899".to_string(),
|
||||
"#6366F1".to_string(),
|
||||
"#14B8A6".to_string(),
|
||||
"#F3B806".to_string(),
|
||||
"#8B5A2B".to_string(),
|
||||
"#6B7280".to_string(),
|
||||
"#DC2626".to_string(),
|
||||
"#7C3AED".to_string(),
|
||||
]
|
||||
// Fall back to default colors
|
||||
get_default_event_colors()
|
||||
}
|
||||
|
||||
async fn save_custom_colors_to_preferences(colors: Vec<String>) -> Result<(), String> {
|
||||
// Create the JSON structure for storing custom colors
|
||||
let colors_json = serde_json::json!({
|
||||
"custom_palette": colors
|
||||
});
|
||||
|
||||
// Convert to string for preferences storage
|
||||
let colors_string = serde_json::to_string(&colors_json)
|
||||
.map_err(|e| format!("Failed to serialize colors: {}", e))?;
|
||||
|
||||
// Update preferences via the preferences service
|
||||
let preferences_service = crate::services::preferences::PreferencesService::new();
|
||||
preferences_service.update_preference("calendar_colors", serde_json::Value::String(colors_string)).await
|
||||
}
|
||||
|
||||
#[function_component]
|
||||
@@ -96,6 +121,8 @@ pub fn App() -> Html {
|
||||
let color_picker_open = use_state(|| -> Option<String> { None });
|
||||
let calendar_management_modal_open = use_state(|| false);
|
||||
let context_menu_open = use_state(|| false);
|
||||
let color_editor_open = use_state(|| false);
|
||||
let color_editor_data = use_state(|| -> Option<(usize, String)> { None }); // (index, current_color)
|
||||
let context_menu_pos = use_state(|| (0i32, 0i32));
|
||||
let context_menu_calendar_path = use_state(|| -> Option<String> { None });
|
||||
let event_context_menu_open = use_state(|| false);
|
||||
@@ -155,7 +182,15 @@ pub fn App() -> Html {
|
||||
}
|
||||
});
|
||||
|
||||
let available_colors = use_state(|| get_theme_event_colors());
|
||||
let available_colors = use_state(|| get_event_colors_from_preferences());
|
||||
|
||||
// Refresh colors when preferences might have changed
|
||||
let refresh_colors = {
|
||||
let available_colors = available_colors.clone();
|
||||
Callback::from(move |_| {
|
||||
available_colors.set(get_event_colors_from_preferences());
|
||||
})
|
||||
};
|
||||
|
||||
// Function to refresh calendar data without full page reload
|
||||
let refresh_calendar_data = {
|
||||
@@ -163,12 +198,14 @@ pub fn App() -> Html {
|
||||
let auth_token = auth_token.clone();
|
||||
let external_calendars = external_calendars.clone();
|
||||
let external_calendar_events = external_calendar_events.clone();
|
||||
let refresh_colors = refresh_colors.clone();
|
||||
|
||||
Callback::from(move |_| {
|
||||
let user_info = user_info.clone();
|
||||
let auth_token = auth_token.clone();
|
||||
let external_calendars = external_calendars.clone();
|
||||
let external_calendar_events = external_calendar_events.clone();
|
||||
let refresh_colors = refresh_colors.clone();
|
||||
|
||||
wasm_bindgen_futures::spawn_local(async move {
|
||||
// Refresh main calendar data if authenticated
|
||||
@@ -211,6 +248,8 @@ pub fn App() -> Html {
|
||||
// Add timestamp to force re-render
|
||||
info.last_updated = (js_sys::Date::now() / 1000.0) as u64;
|
||||
user_info.set(Some(info));
|
||||
// Refresh colors after loading user preferences
|
||||
refresh_colors.emit(());
|
||||
}
|
||||
Err(err) => {
|
||||
web_sys::console::log_1(
|
||||
@@ -283,6 +322,49 @@ pub fn App() -> Html {
|
||||
})
|
||||
};
|
||||
|
||||
let on_color_editor_open = {
|
||||
let color_editor_open = color_editor_open.clone();
|
||||
let color_editor_data = color_editor_data.clone();
|
||||
Callback::from(move |(index, color): (usize, String)| {
|
||||
color_editor_data.set(Some((index, color)));
|
||||
color_editor_open.set(true);
|
||||
})
|
||||
};
|
||||
|
||||
let on_color_editor_close = {
|
||||
let color_editor_open = color_editor_open.clone();
|
||||
Callback::from(move |_| {
|
||||
color_editor_open.set(false);
|
||||
})
|
||||
};
|
||||
|
||||
let on_color_editor_save = {
|
||||
let available_colors = available_colors.clone();
|
||||
let color_editor_open = color_editor_open.clone();
|
||||
let refresh_colors = refresh_colors.clone();
|
||||
Callback::from(move |(index, new_color): (usize, String)| {
|
||||
// Update the colors array
|
||||
let mut colors = (*available_colors).clone();
|
||||
if index < colors.len() {
|
||||
colors[index] = new_color;
|
||||
available_colors.set(colors.clone());
|
||||
|
||||
// Save to preferences asynchronously
|
||||
let colors_for_save = colors.clone();
|
||||
let refresh_colors = refresh_colors.clone();
|
||||
wasm_bindgen_futures::spawn_local(async move {
|
||||
if let Err(e) = save_custom_colors_to_preferences(colors_for_save).await {
|
||||
web_sys::console::log_1(&format!("Failed to save custom colors: {}", e).into());
|
||||
} else {
|
||||
// Refresh colors to ensure UI is in sync
|
||||
refresh_colors.emit(());
|
||||
}
|
||||
});
|
||||
}
|
||||
color_editor_open.set(false);
|
||||
})
|
||||
};
|
||||
|
||||
let on_view_change = {
|
||||
let current_view = current_view.clone();
|
||||
Callback::from(move |new_view: ViewMode| {
|
||||
@@ -300,7 +382,6 @@ pub fn App() -> Html {
|
||||
|
||||
let on_theme_change = {
|
||||
let current_theme = current_theme.clone();
|
||||
let available_colors = available_colors.clone();
|
||||
Callback::from(move |new_theme: Theme| {
|
||||
// Save theme to localStorage
|
||||
let _ = LocalStorage::set("calendar_theme", new_theme.value());
|
||||
@@ -315,8 +396,7 @@ pub fn App() -> Html {
|
||||
// Update state
|
||||
current_theme.set(new_theme);
|
||||
|
||||
// Update available colors after theme change
|
||||
available_colors.set(get_theme_event_colors());
|
||||
// Colors are now unified and don't change with themes
|
||||
})
|
||||
};
|
||||
|
||||
@@ -1386,6 +1466,7 @@ pub fn App() -> Html {
|
||||
on_theme_change={on_theme_change}
|
||||
current_style={(*current_style).clone()}
|
||||
on_style_change={on_style_change}
|
||||
on_color_editor_open={on_color_editor_open}
|
||||
/>
|
||||
<main class="app-main">
|
||||
<RouteHandler
|
||||
@@ -1714,6 +1795,15 @@ pub fn App() -> Html {
|
||||
is_open={*mobile_warning_open}
|
||||
on_close={on_mobile_warning_close}
|
||||
/>
|
||||
|
||||
// Color editor modal
|
||||
<ColorEditorModal
|
||||
is_open={*color_editor_open}
|
||||
current_color={color_editor_data.as_ref().map(|(_, color)| color.clone()).unwrap_or_default()}
|
||||
color_index={color_editor_data.as_ref().map(|(index, _)| *index).unwrap_or(0)}
|
||||
on_close={on_color_editor_close}
|
||||
on_save={on_color_editor_save}
|
||||
/>
|
||||
</div>
|
||||
|
||||
// Hidden print copy that gets shown only during printing
|
||||
|
||||
@@ -9,6 +9,7 @@ pub struct CalendarListItemProps {
|
||||
pub on_color_change: Callback<(String, String)>, // (calendar_path, color)
|
||||
pub on_color_picker_toggle: Callback<String>, // calendar_path
|
||||
pub available_colors: Vec<String>,
|
||||
pub on_color_editor_open: Callback<(usize, String)>, // (index, current_color)
|
||||
pub on_context_menu: Callback<(MouseEvent, String)>, // (event, calendar_path)
|
||||
pub on_visibility_toggle: Callback<String>, // calendar_path
|
||||
}
|
||||
@@ -66,13 +67,25 @@ pub fn calendar_list_item(props: &CalendarListItemProps) -> Html {
|
||||
on_color_change.emit((cal_path.clone(), color_str.clone()));
|
||||
});
|
||||
|
||||
let on_color_right_click = {
|
||||
let on_color_editor_open = props.on_color_editor_open.clone();
|
||||
let color_index = props.available_colors.iter().position(|c| c == color).unwrap_or(0);
|
||||
let color_str = color.clone();
|
||||
Callback::from(move |e: MouseEvent| {
|
||||
e.prevent_default();
|
||||
e.stop_propagation();
|
||||
on_color_editor_open.emit((color_index, color_str.clone()));
|
||||
})
|
||||
};
|
||||
|
||||
let is_selected = props.calendar.color == *color;
|
||||
let class_name = if is_selected { "color-option selected" } else { "color-option" };
|
||||
|
||||
html! {
|
||||
<div class={class_name}
|
||||
style={format!("background-color: {}", color)}
|
||||
onclick={on_color_select}>
|
||||
onclick={on_color_select}
|
||||
oncontextmenu={on_color_right_click}>
|
||||
</div>
|
||||
}
|
||||
}).collect::<Html>()
|
||||
|
||||
153
frontend/src/components/color_editor_modal.rs
Normal file
153
frontend/src/components/color_editor_modal.rs
Normal file
@@ -0,0 +1,153 @@
|
||||
use yew::prelude::*;
|
||||
use web_sys::HtmlInputElement;
|
||||
use wasm_bindgen::JsCast;
|
||||
|
||||
#[derive(Properties, PartialEq)]
|
||||
pub struct ColorEditorModalProps {
|
||||
pub is_open: bool,
|
||||
pub current_color: String,
|
||||
pub color_index: usize,
|
||||
pub on_close: Callback<()>,
|
||||
pub on_save: Callback<(usize, String)>, // (index, new_color)
|
||||
}
|
||||
|
||||
#[function_component(ColorEditorModal)]
|
||||
pub fn color_editor_modal(props: &ColorEditorModalProps) -> Html {
|
||||
let selected_color = use_state(|| props.current_color.clone());
|
||||
|
||||
// Reset selected color when modal opens with new color
|
||||
{
|
||||
let selected_color = selected_color.clone();
|
||||
use_effect_with(props.current_color.clone(), move |current_color| {
|
||||
selected_color.set(current_color.clone());
|
||||
});
|
||||
}
|
||||
|
||||
let on_color_input = {
|
||||
let selected_color = selected_color.clone();
|
||||
Callback::from(move |e: InputEvent| {
|
||||
if let Some(input) = e.target_dyn_into::<HtmlInputElement>() {
|
||||
selected_color.set(input.value());
|
||||
}
|
||||
})
|
||||
};
|
||||
|
||||
let on_save_click = {
|
||||
let selected_color = selected_color.clone();
|
||||
let on_save = props.on_save.clone();
|
||||
let color_index = props.color_index;
|
||||
Callback::from(move |_| {
|
||||
on_save.emit((color_index, (*selected_color).clone()));
|
||||
})
|
||||
};
|
||||
|
||||
let on_backdrop_click = {
|
||||
let on_close = props.on_close.clone();
|
||||
Callback::from(move |e: MouseEvent| {
|
||||
// Only close if clicking the backdrop, not the modal content
|
||||
if let Some(target) = e.target() {
|
||||
if let Some(element) = target.dyn_ref::<web_sys::Element>() {
|
||||
if element.class_list().contains("color-editor-backdrop") {
|
||||
on_close.emit(());
|
||||
}
|
||||
}
|
||||
}
|
||||
})
|
||||
};
|
||||
|
||||
if !props.is_open {
|
||||
return html! {};
|
||||
}
|
||||
|
||||
// Predefined color suggestions
|
||||
let suggested_colors = vec![
|
||||
"#3B82F6", "#10B981", "#F59E0B", "#EF4444", "#8B5CF6", "#06B6D4",
|
||||
"#84CC16", "#F97316", "#EC4899", "#6366F1", "#14B8A6", "#F3B806",
|
||||
"#8B5A2B", "#6B7280", "#DC2626", "#7C3AED", "#F87171", "#34D399",
|
||||
"#FBBF24", "#A78BFA", "#60A5FA", "#2DD4BF", "#FB7185", "#FDBA74",
|
||||
];
|
||||
|
||||
html! {
|
||||
<div class="color-editor-backdrop" onclick={on_backdrop_click}>
|
||||
<div class="color-editor-modal">
|
||||
<div class="color-editor-header">
|
||||
<h3>{"Edit Color"}</h3>
|
||||
<button class="close-button" onclick={Callback::from({
|
||||
let on_close = props.on_close.clone();
|
||||
move |_| on_close.emit(())
|
||||
})}>
|
||||
{"×"}
|
||||
</button>
|
||||
</div>
|
||||
|
||||
<div class="color-editor-content">
|
||||
<div class="current-color-preview">
|
||||
<div
|
||||
class="color-preview-large"
|
||||
style={format!("background-color: {}", *selected_color)}
|
||||
></div>
|
||||
<span class="color-value">{&*selected_color}</span>
|
||||
</div>
|
||||
|
||||
<div class="color-input-section">
|
||||
<label for="color-picker">{"Custom Color:"}</label>
|
||||
<div class="color-input-group">
|
||||
<input
|
||||
type="color"
|
||||
id="color-picker"
|
||||
value={(*selected_color).clone()}
|
||||
oninput={on_color_input.clone()}
|
||||
/>
|
||||
<input
|
||||
type="text"
|
||||
class="color-text-input"
|
||||
value={(*selected_color).clone()}
|
||||
oninput={on_color_input}
|
||||
placeholder="#000000"
|
||||
/>
|
||||
</div>
|
||||
</div>
|
||||
|
||||
<div class="suggested-colors-section">
|
||||
<label>{"Suggested Colors:"}</label>
|
||||
<div class="suggested-colors-grid">
|
||||
{
|
||||
suggested_colors.iter().map(|color| {
|
||||
let color = color.to_string();
|
||||
let selected_color = selected_color.clone();
|
||||
let onclick = {
|
||||
let color = color.clone();
|
||||
Callback::from(move |_| {
|
||||
selected_color.set(color.clone());
|
||||
})
|
||||
};
|
||||
|
||||
html! {
|
||||
<div
|
||||
class="suggested-color"
|
||||
style={format!("background-color: {}", color)}
|
||||
onclick={onclick}
|
||||
title={color.clone()}
|
||||
></div>
|
||||
}
|
||||
}).collect::<Html>()
|
||||
}
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
|
||||
<div class="color-editor-footer">
|
||||
<button class="cancel-button" onclick={Callback::from({
|
||||
let on_close = props.on_close.clone();
|
||||
move |_| on_close.emit(())
|
||||
})}>
|
||||
{"Cancel"}
|
||||
</button>
|
||||
<button class="save-button" onclick={on_save_click}>
|
||||
{"Save"}
|
||||
</button>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
}
|
||||
}
|
||||
@@ -3,6 +3,7 @@ pub mod calendar_context_menu;
|
||||
pub mod calendar_management_modal;
|
||||
pub mod calendar_header;
|
||||
pub mod calendar_list_item;
|
||||
pub mod color_editor_modal;
|
||||
pub mod context_menu;
|
||||
pub mod create_calendar_modal;
|
||||
pub mod create_event_modal;
|
||||
@@ -24,6 +25,7 @@ pub use calendar_context_menu::CalendarContextMenu;
|
||||
pub use calendar_management_modal::CalendarManagementModal;
|
||||
pub use calendar_header::CalendarHeader;
|
||||
pub use calendar_list_item::CalendarListItem;
|
||||
pub use color_editor_modal::ColorEditorModal;
|
||||
pub use context_menu::ContextMenu;
|
||||
pub use create_event_modal::CreateEventModal;
|
||||
// Re-export event form types for backwards compatibility
|
||||
|
||||
@@ -99,6 +99,7 @@ pub struct SidebarProps {
|
||||
pub on_color_change: Callback<(String, String)>,
|
||||
pub on_color_picker_toggle: Callback<String>,
|
||||
pub available_colors: Vec<String>,
|
||||
pub on_color_editor_open: Callback<(usize, String)>, // (index, current_color)
|
||||
pub refreshing_calendar_id: Option<i32>,
|
||||
pub on_calendar_context_menu: Callback<(MouseEvent, String)>,
|
||||
pub on_calendar_visibility_toggle: Callback<String>,
|
||||
@@ -209,6 +210,7 @@ pub fn sidebar(props: &SidebarProps) -> Html {
|
||||
on_color_change={props.on_color_change.clone()}
|
||||
on_color_picker_toggle={props.on_color_picker_toggle.clone()}
|
||||
available_colors={props.available_colors.clone()}
|
||||
on_color_editor_open={props.on_color_editor_open.clone()}
|
||||
on_context_menu={props.on_calendar_context_menu.clone()}
|
||||
on_visibility_toggle={props.on_calendar_visibility_toggle.clone()}
|
||||
/>
|
||||
@@ -290,6 +292,17 @@ pub fn sidebar(props: &SidebarProps) -> Html {
|
||||
on_color_change.emit((external_id.clone(), color_str.clone()));
|
||||
});
|
||||
|
||||
let on_color_right_click = {
|
||||
let on_color_editor_open = props.on_color_editor_open.clone();
|
||||
let color_index = props.available_colors.iter().position(|c| c == color).unwrap_or(0);
|
||||
let color_str = color.clone();
|
||||
Callback::from(move |e: MouseEvent| {
|
||||
e.prevent_default();
|
||||
e.stop_propagation();
|
||||
on_color_editor_open.emit((color_index, color_str.clone()));
|
||||
})
|
||||
};
|
||||
|
||||
let is_selected = cal.color == *color;
|
||||
|
||||
html! {
|
||||
@@ -298,6 +311,7 @@ pub fn sidebar(props: &SidebarProps) -> Html {
|
||||
class={if is_selected { "color-option selected" } else { "color-option" }}
|
||||
style={format!("background-color: {}", color)}
|
||||
onclick={on_color_select}
|
||||
oncontextmenu={on_color_right_click}
|
||||
/>
|
||||
}
|
||||
}).collect::<Html>()
|
||||
|
||||
@@ -4186,3 +4186,207 @@ body {
|
||||
z-index: 1;
|
||||
}
|
||||
|
||||
/* Color Editor Modal */
|
||||
.color-editor-backdrop {
|
||||
position: fixed;
|
||||
top: 0;
|
||||
left: 0;
|
||||
right: 0;
|
||||
bottom: 0;
|
||||
background: rgba(0, 0, 0, 0.5);
|
||||
backdrop-filter: blur(4px);
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: center;
|
||||
z-index: 1000;
|
||||
}
|
||||
|
||||
.color-editor-modal {
|
||||
background: var(--modal-background);
|
||||
color: var(--modal-text);
|
||||
border-radius: var(--border-radius-medium);
|
||||
box-shadow: var(--shadow-lg);
|
||||
max-width: 400px;
|
||||
width: 95%;
|
||||
max-height: 80vh;
|
||||
overflow-y: auto;
|
||||
position: relative;
|
||||
animation: modalAppear 0.25s cubic-bezier(0.4, 0, 0.2, 1);
|
||||
}
|
||||
|
||||
.color-editor-header {
|
||||
display: flex;
|
||||
justify-content: space-between;
|
||||
align-items: center;
|
||||
padding: var(--spacing-md);
|
||||
border-bottom: 1px solid var(--modal-header-border);
|
||||
background: var(--modal-header-background);
|
||||
border-radius: var(--border-radius-medium) var(--border-radius-medium) 0 0;
|
||||
}
|
||||
|
||||
.color-editor-header h3 {
|
||||
margin: 0;
|
||||
font-size: 1.1rem;
|
||||
font-weight: 600;
|
||||
color: var(--text-primary);
|
||||
}
|
||||
|
||||
.close-button {
|
||||
background: none;
|
||||
border: none;
|
||||
font-size: 1.5rem;
|
||||
color: var(--text-secondary);
|
||||
cursor: pointer;
|
||||
padding: var(--spacing-xs);
|
||||
line-height: 1;
|
||||
border-radius: var(--border-radius-small);
|
||||
transition: var(--transition-fast);
|
||||
}
|
||||
|
||||
.close-button:hover {
|
||||
background: var(--background-tertiary);
|
||||
color: var(--text-primary);
|
||||
}
|
||||
|
||||
.color-editor-content {
|
||||
padding: var(--spacing-md);
|
||||
}
|
||||
|
||||
.current-color-preview {
|
||||
display: flex;
|
||||
align-items: center;
|
||||
gap: var(--spacing-md);
|
||||
margin-bottom: var(--spacing-md);
|
||||
padding: var(--spacing-md);
|
||||
background: var(--background-tertiary);
|
||||
border-radius: var(--border-radius-medium);
|
||||
}
|
||||
|
||||
.color-preview-large {
|
||||
width: 48px;
|
||||
height: 48px;
|
||||
border-radius: var(--border-radius-medium);
|
||||
border: 2px solid var(--border-secondary);
|
||||
flex-shrink: 0;
|
||||
}
|
||||
|
||||
.color-value {
|
||||
font-family: monospace;
|
||||
font-size: 0.9rem;
|
||||
color: var(--text-secondary);
|
||||
font-weight: 500;
|
||||
}
|
||||
|
||||
.color-input-section {
|
||||
margin-bottom: var(--spacing-lg);
|
||||
}
|
||||
|
||||
.color-input-section label {
|
||||
display: block;
|
||||
margin-bottom: var(--spacing-sm);
|
||||
font-weight: 500;
|
||||
color: var(--text-primary);
|
||||
}
|
||||
|
||||
.color-input-group {
|
||||
display: flex;
|
||||
gap: var(--spacing-sm);
|
||||
align-items: center;
|
||||
}
|
||||
|
||||
.color-input-group input[type="color"] {
|
||||
width: 48px;
|
||||
height: 40px;
|
||||
border: 1px solid var(--border-secondary);
|
||||
border-radius: var(--border-radius-small);
|
||||
cursor: pointer;
|
||||
background: none;
|
||||
padding: 0;
|
||||
}
|
||||
|
||||
.color-text-input {
|
||||
flex: 1;
|
||||
padding: var(--spacing-sm) var(--spacing-md);
|
||||
border: 1px solid var(--border-secondary);
|
||||
border-radius: var(--border-radius-small);
|
||||
font-family: monospace;
|
||||
font-size: 0.9rem;
|
||||
background: var(--background-secondary);
|
||||
color: var(--text-primary);
|
||||
transition: var(--transition-fast);
|
||||
}
|
||||
|
||||
.color-text-input:focus {
|
||||
outline: none;
|
||||
border-color: var(--info-color);
|
||||
box-shadow: 0 0 0 2px rgba(23, 162, 184, 0.2);
|
||||
}
|
||||
|
||||
.suggested-colors-section label {
|
||||
display: block;
|
||||
margin-bottom: var(--spacing-sm);
|
||||
font-weight: 500;
|
||||
color: var(--text-primary);
|
||||
}
|
||||
|
||||
.suggested-colors-grid {
|
||||
display: grid;
|
||||
grid-template-columns: repeat(8, 1fr);
|
||||
gap: var(--spacing-sm);
|
||||
}
|
||||
|
||||
.suggested-color {
|
||||
width: 32px;
|
||||
height: 32px;
|
||||
border-radius: var(--border-radius-small);
|
||||
border: 2px solid var(--border-secondary);
|
||||
cursor: pointer;
|
||||
transition: var(--transition-fast);
|
||||
}
|
||||
|
||||
.suggested-color:hover {
|
||||
transform: scale(1.1);
|
||||
border-color: var(--text-primary);
|
||||
}
|
||||
|
||||
.color-editor-footer {
|
||||
display: flex;
|
||||
justify-content: flex-end;
|
||||
gap: var(--spacing-sm);
|
||||
padding: var(--spacing-md);
|
||||
border-top: 1px solid var(--modal-header-border);
|
||||
background: var(--background-tertiary);
|
||||
border-radius: 0 0 var(--border-radius-medium) var(--border-radius-medium);
|
||||
}
|
||||
|
||||
.cancel-button, .save-button {
|
||||
padding: var(--spacing-sm) var(--spacing-md);
|
||||
border: 1px solid var(--border-secondary);
|
||||
border-radius: var(--border-radius-small);
|
||||
cursor: pointer;
|
||||
font-size: 0.9rem;
|
||||
font-weight: 500;
|
||||
transition: var(--transition-fast);
|
||||
}
|
||||
|
||||
.cancel-button {
|
||||
background: var(--background-secondary);
|
||||
color: var(--text-secondary);
|
||||
}
|
||||
|
||||
.cancel-button:hover {
|
||||
background: var(--background-tertiary);
|
||||
color: var(--text-primary);
|
||||
}
|
||||
|
||||
.save-button {
|
||||
background: var(--info-color);
|
||||
color: white;
|
||||
border-color: var(--info-color);
|
||||
}
|
||||
|
||||
.save-button:hover {
|
||||
background: #138496;
|
||||
border-color: #138496;
|
||||
}
|
||||
|
||||
|
||||
Reference in New Issue
Block a user